C27H31F6N2NaO2 — CID 46231577
sodium 2-[(2S,4R)-2-[4-(trifluoromethyl)phenyl]-1-[(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]heptyl]piperidin-4-yl]acetate (PubChem CID 46231577) has the molecular formula C27H31F6N2NaO2 and a molecular weight of 552.54 g/mol. Its IUPAC name is sodium 2-[(2S,4R)-2-[4-(trifluoromethyl)phenyl]-1-[(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]heptyl]piperidin-4-yl]acetate.
| Compound Name | sodium 2-[(2S,4R)-2-[4-(trifluoromethyl)phenyl]-1-[(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]heptyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 46231577 |
| Molecular Formula | C27H31F6N2NaO2 |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | sodium 2-[(2S,4R)-2-[4-(trifluoromethyl)phenyl]-1-[(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]heptyl]piperidin-4-yl]acetate |
| SMILES | CCCCCC[C@H](c1ccc(C(F)(F)F)nc1)N1CC[C@@H](CC(=O)[O-])C[C@H]1c1ccc(C(F)(F)F)cc1.[Na+] |
| InChI | InChI=1S/C27H32F6N2O2.Na/c1-2-3-4-5-6-22(20-9-12-24(34-17-20)27(31,32)33)35-14-13-18(16-25(36)37)15-23(35)19-7-10-21(11-8-19)26(28,29)30;/h7-12,17-18,22-23H,2-6,13-16H2,1H3,(H,36,37);/q;+1/p-1/t18-,22-,23+;/m1./s1 |
| InChIKey | YJPQFCOIJAWMIC-JJKVBFQYSA-M |
| XLogP | 3.73 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|