C30H50N2O3S — CID 46231637
(4R)-2-(3,4-dimethoxyphenyl)-N-[(E)-octadec-8-enyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 46231637) has the molecular formula C30H50N2O3S and a molecular weight of 518.81 g/mol. Its IUPAC name is (4R)-2-(3,4-dimethoxyphenyl)-N-[(E)-octadec-8-enyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-2-(3,4-dimethoxyphenyl)-N-[(E)-octadec-8-enyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 46231637 |
| Molecular Formula | C30H50N2O3S |
| Molecular Weight | 518.81 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | (4R)-2-(3,4-dimethoxyphenyl)-N-[(E)-octadec-8-enyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCCCCC/C=C/CCCCCCCNC(=O)[C@@H]1CSC(c2ccc(OC)c(OC)c2)N1 |
| InChI | InChI=1S/C30H50N2O3S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-31-29(33)26-24-36-30(32-26)25-20-21-27(34-2)28(23-25)35-3/h12-13,20-21,23,26,30,32H,4-11,14-19,22,24H2,1-3H3,(H,31,33)/b13-12+/t26-,30?/m0/s1 |
| InChIKey | HGPSVGGKDMVPFK-DFNOAGGUSA-N |
| XLogP | 7.56 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.81 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|