C16H10ClF3N2O3S — CID 46231718
5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 46231718) has the molecular formula C16H10ClF3N2O3S and a molecular weight of 402.78 g/mol. Its IUPAC name is 5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 46231718 |
| Molecular Formula | C16H10ClF3N2O3S |
| Molecular Weight | 402.78 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 5-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(Oc3ncc(C(F)(F)F)cc3Cl)cc2)S1 |
| InChI | InChI=1S/C16H10ClF3N2O3S/c17-11-6-9(16(18,19)20)7-21-14(11)25-10-3-1-8(2-4-10)5-12-13(23)22-15(24)26-12/h1-4,6-7,12H,5H2,(H,22,23,24) |
| InChIKey | NCXQJPOFNFYTTM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|