About 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide
4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide (PubChem CID 46231850) has the molecular formula C18H20N6OS
and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide |
| PubChem CID | 46231850 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCN(c3nc(N)nc4sccc34)CC2)c1 |
| InChI | InChI=1S/C18H20N6OS/c1-12-3-2-4-13(11-12)20-18(25)24-8-6-23(7-9-24)15-14-5-10-26-16(14)22-17(19)21-15/h2-5,10-11H,6-9H2,1H3,(H,20,25)(H2,19,21,22) |
| InChIKey | RDAAIBFISRFGQX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide?
The IUPAC name of 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide (CID 46231850) is 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide.
What is the SMILES notation for 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide?
The canonical SMILES for 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide is Cc1cccc(NC(=O)N2CCN(c3nc(N)nc4sccc34)CC2)c1.
What is the InChIKey of 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide?
The InChIKey is RDAAIBFISRFGQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N6OS/c1-12-3-2-4-13(11-12)20-18(25)24-8-6-23(7-9-24)15-14-5-10-26-16(14)22-17(19)21-15/h2-5,10-11H,6-9H2,1H3,(H,20,25)(H2,19,21,22).
What are the key properties of 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide?
4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide has a molecular weight of 368.47 g/mol, XLogP of 2.94, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-N-(3-methylphenyl)piperazine-1-carboxamide is sourced from PubChem (CID 46231850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).