About 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide
2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide (PubChem CID 46231854) has the molecular formula C19H22N6OS
and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide |
| PubChem CID | 46231854 |
| Molecular Formula | C19H22N6OS |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide |
| SMILES | CN(C(=O)CN1CCN(c2nc(N)nc3sccc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H22N6OS/c1-23(14-5-3-2-4-6-14)16(26)13-24-8-10-25(11-9-24)17-15-7-12-27-18(15)22-19(20)21-17/h2-7,12H,8-11,13H2,1H3,(H2,20,21,22) |
| InChIKey | WBMYAUPBDJIBKB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide?
The IUPAC name of 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide (CID 46231854) is 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide.
What is the SMILES notation for 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide?
The canonical SMILES for 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide is CN(C(=O)CN1CCN(c2nc(N)nc3sccc23)CC1)c1ccccc1.
What is the InChIKey of 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide?
The InChIKey is WBMYAUPBDJIBKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N6OS/c1-23(14-5-3-2-4-6-14)16(26)13-24-8-10-25(11-9-24)17-15-7-12-27-18(15)22-19(20)21-17/h2-7,12H,8-11,13H2,1H3,(H2,20,21,22).
What are the key properties of 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide?
2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide has a molecular weight of 382.49 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-aminothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-N-methyl-N-phenylacetamide is sourced from PubChem (CID 46231854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).