C34H45N3O8 — CID 46231977
(1E,4E)-1-[4-[[1-(9-hydroxynonyl)triazol-4-yl]methoxy]-3,5-dimethoxyphenyl]-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one (PubChem CID 46231977) has the molecular formula C34H45N3O8 and a molecular weight of 623.75 g/mol. Its IUPAC name is (1E,4E)-1-[4-[[1-(9-hydroxynonyl)triazol-4-yl]methoxy]-3,5-dimethoxyphenyl]-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[4-[[1-(9-hydroxynonyl)triazol-4-yl]methoxy]-3,5-dimethoxyphenyl]-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 46231977 |
| Molecular Formula | C34H45N3O8 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.32 |
| IUPAC Name | (1E,4E)-1-[4-[[1-(9-hydroxynonyl)triazol-4-yl]methoxy]-3,5-dimethoxyphenyl]-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2cc(OC)c(OCc3cn(CCCCCCCCCO)nn3)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C34H45N3O8/c1-40-29-19-25(20-30(41-2)33(29)44-5)13-15-28(39)16-14-26-21-31(42-3)34(32(22-26)43-4)45-24-27-23-37(36-35-27)17-11-9-7-6-8-10-12-18-38/h13-16,19-23,38H,6-12,17-18,24H2,1-5H3/b15-13+,16-14+ |
| InChIKey | NYNFWUUQXBKMLF-WXUKJITCSA-N |
| XLogP | 5.92 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|