C40H56N4O9 — CID 46231978
tert-butyl N-[10-[4-[[2,6-dimethoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]decyl]carbamate (PubChem CID 46231978) has the molecular formula C40H56N4O9 and a molecular weight of 736.91 g/mol. Its IUPAC name is tert-butyl N-[10-[4-[[2,6-dimethoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]decyl]carbamate.
| Compound Name | tert-butyl N-[10-[4-[[2,6-dimethoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]decyl]carbamate |
|---|---|
| PubChem CID | 46231978 |
| Molecular Formula | C40H56N4O9 |
| Molecular Weight | 736.91 g/mol |
| Exact Mass | 736.40 |
| IUPAC Name | tert-butyl N-[10-[4-[[2,6-dimethoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]decyl]carbamate |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2cc(OC)c(OCc3cn(CCCCCCCCCCNC(=O)OC(C)(C)C)nn3)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C40H56N4O9/c1-40(2,3)53-39(46)41-21-15-13-11-9-10-12-14-16-22-44-27-31(42-43-44)28-52-38-35(49-6)25-30(26-36(38)50-7)18-20-32(45)19-17-29-23-33(47-4)37(51-8)34(24-29)48-5/h17-20,23-27H,9-16,21-22,28H2,1-8H3,(H,41,46)/b19-17+,20-18+ |
| InChIKey | GJCKOHDBNYQGOF-XPWSMXQVSA-N |
| XLogP | 7.84 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.91 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|