C37H41N3O9 — CID 46231979
(1E,4E)-1-[3,5-dimethoxy-4-[[1-[[4-(oxan-2-yloxy)phenyl]methyl]triazol-4-yl]methoxy]phenyl]-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one (PubChem CID 46231979) has the molecular formula C37H41N3O9 and a molecular weight of 671.75 g/mol. Its IUPAC name is (1E,4E)-1-[3,5-dimethoxy-4-[[1-[[4-(oxan-2-yloxy)phenyl]methyl]triazol-4-yl]methoxy]phenyl]-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[3,5-dimethoxy-4-[[1-[[4-(oxan-2-yloxy)phenyl]methyl]triazol-4-yl]methoxy]phenyl]-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 46231979 |
| Molecular Formula | C37H41N3O9 |
| Molecular Weight | 671.75 g/mol |
| Exact Mass | 671.28 |
| IUPAC Name | (1E,4E)-1-[3,5-dimethoxy-4-[[1-[[4-(oxan-2-yloxy)phenyl]methyl]triazol-4-yl]methoxy]phenyl]-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2cc(OC)c(OCc3cn(Cc4ccc(OC5CCCCO5)cc4)nn3)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C37H41N3O9/c1-42-31-18-26(19-32(43-2)36(31)46-5)9-13-29(41)14-10-27-20-33(44-3)37(34(21-27)45-4)48-24-28-23-40(39-38-28)22-25-11-15-30(16-12-25)49-35-8-6-7-17-47-35/h9-16,18-21,23,35H,6-8,17,22,24H2,1-5H3/b13-9+,14-10+ |
| InChIKey | NWLLDQUAAKZMPD-UTLPMFLDSA-N |
| XLogP | 6.15 |
| TPSA | 121.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.75 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|