C29H28BrNO5 — CID 46232036
17-methoxy-16-(4-phenoxybutoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide (PubChem CID 46232036) has the molecular formula C29H28BrNO5 and a molecular weight of 550.45 g/mol. Its IUPAC name is 17-methoxy-16-(4-phenoxybutoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide.
| Compound Name | 17-methoxy-16-(4-phenoxybutoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide |
|---|---|
| PubChem CID | 46232036 |
| Molecular Formula | C29H28BrNO5 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | 17-methoxy-16-(4-phenoxybutoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide |
| SMILES | COc1ccc2cc3[n+](cc2c1OCCCCOc1ccccc1)CCc1cc2c(cc1-3)OCO2.[Br-] |
| InChI | InChI=1S/C29H28NO5.BrH/c1-31-26-10-9-20-15-25-23-17-28-27(34-19-35-28)16-21(23)11-12-30(25)18-24(20)29(26)33-14-6-5-13-32-22-7-3-2-4-8-22;/h2-4,7-10,15-18H,5-6,11-14,19H2,1H3;1H/q+1;/p-1 |
| InChIKey | RGAFBRYQCWMODS-UHFFFAOYSA-M |
| XLogP | 2.33 |
| TPSA | 50.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|