About 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole
2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole (PubChem CID 46232085) has the molecular formula C20H22N2O
and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole |
| PubChem CID | 46232085 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole |
| SMILES | COc1ccc(-c2c(C)cccc2C)cc1-c1nc(C)c(C)[nH]1 |
| InChI | InChI=1S/C20H22N2O/c1-12-7-6-8-13(2)19(12)16-9-10-18(23-5)17(11-16)20-21-14(3)15(4)22-20/h6-11H,1-5H3,(H,21,22) |
| InChIKey | CBCQTSHECCGKJB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole?
The IUPAC name of 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole (CID 46232085) is 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole.
What is the SMILES notation for 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole?
The canonical SMILES for 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole is COc1ccc(-c2c(C)cccc2C)cc1-c1nc(C)c(C)[nH]1.
What is the InChIKey of 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole?
The InChIKey is CBCQTSHECCGKJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O/c1-12-7-6-8-13(2)19(12)16-9-10-18(23-5)17(11-16)20-21-14(3)15(4)22-20/h6-11H,1-5H3,(H,21,22).
What are the key properties of 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole?
2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole has a molecular weight of 306.41 g/mol, XLogP of 4.99, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,6-dimethylphenyl)-2-methoxyphenyl]-4,5-dimethyl-1H-imidazole is sourced from PubChem (CID 46232085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).