About 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole
2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole (PubChem CID 46232148) has the molecular formula C26H26N2O
and a molecular weight of 382.51 g/mol. Its IUPAC name is 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole |
| PubChem CID | 46232148 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole |
| SMILES | Cc1cccc(C)c1-c1ccc(OCc2ccccc2)c(-c2nc(C)c(C)[nH]2)c1 |
| InChI | InChI=1S/C26H26N2O/c1-17-9-8-10-18(2)25(17)22-13-14-24(29-16-21-11-6-5-7-12-21)23(15-22)26-27-19(3)20(4)28-26/h5-15H,16H2,1-4H3,(H,27,28) |
| InChIKey | NQZGDVLIIMYDHB-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole?
The IUPAC name of 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole (CID 46232148) is 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole.
What is the SMILES notation for 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole?
The canonical SMILES for 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole is Cc1cccc(C)c1-c1ccc(OCc2ccccc2)c(-c2nc(C)c(C)[nH]2)c1.
What is the InChIKey of 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole?
The InChIKey is NQZGDVLIIMYDHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N2O/c1-17-9-8-10-18(2)25(17)22-13-14-24(29-16-21-11-6-5-7-12-21)23(15-22)26-27-19(3)20(4)28-26/h5-15H,16H2,1-4H3,(H,27,28).
What are the key properties of 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole?
2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole has a molecular weight of 382.51 g/mol, XLogP of 6.56, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,6-dimethylphenyl)-2-phenylmethoxyphenyl]-4,5-dimethyl-1H-imidazole is sourced from PubChem (CID 46232148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).