About 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline
2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline (PubChem CID 46232185) has the molecular formula C28H21NO2S
and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline.
Molecular Properties
| Compound Name | 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline |
| PubChem CID | 46232185 |
| Molecular Formula | C28H21NO2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline |
| SMILES | CS(=O)(=O)c1ccc(-c2nc3ccccc3c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H21NO2S/c1-32(30,31)23-18-16-22(17-19-23)28-27(21-12-6-3-7-13-21)26(20-10-4-2-5-11-20)24-14-8-9-15-25(24)29-28/h2-19H,1H3 |
| InChIKey | LUROKNODFIRYMB-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline?
The IUPAC name of 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline (CID 46232185) is 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline.
What is the SMILES notation for 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline?
The canonical SMILES for 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline is CS(=O)(=O)c1ccc(-c2nc3ccccc3c(-c3ccccc3)c2-c2ccccc2)cc1.
What is the InChIKey of 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline?
The InChIKey is LUROKNODFIRYMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H21NO2S/c1-32(30,31)23-18-16-22(17-19-23)28-27(21-12-6-3-7-13-21)26(20-10-4-2-5-11-20)24-14-8-9-15-25(24)29-28/h2-19H,1H3.
What are the key properties of 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline?
2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline has a molecular weight of 435.55 g/mol, XLogP of 6.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylsulfonylphenyl)-3,4-diphenylquinoline is sourced from PubChem (CID 46232185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).