C20H23FN6O — CID 46232291
3-[4-(5-aminopentylamino)-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]phenol (PubChem CID 46232291) has the molecular formula C20H23FN6O and a molecular weight of 382.44 g/mol. Its IUPAC name is 3-[4-(5-aminopentylamino)-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]phenol.
| Compound Name | 3-[4-(5-aminopentylamino)-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]phenol |
|---|---|
| PubChem CID | 46232291 |
| Molecular Formula | C20H23FN6O |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-[4-(5-aminopentylamino)-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]phenol |
| SMILES | NCCCCCNc1nc(Nc2cccc(F)c2)nc(-c2cccc(O)c2)n1 |
| InChI | InChI=1S/C20H23FN6O/c21-15-7-5-8-16(13-15)24-20-26-18(14-6-4-9-17(28)12-14)25-19(27-20)23-11-3-1-2-10-22/h4-9,12-13,28H,1-3,10-11,22H2,(H2,23,24,25,26,27) |
| InChIKey | BKLDIEBDLYULCF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|