C20H21F2N5 — CID 46232292
N'-[4,6-bis(3-fluorophenyl)-1,3,5-triazin-2-yl]pentane-1,5-diamine (PubChem CID 46232292) has the molecular formula C20H21F2N5 and a molecular weight of 369.42 g/mol. Its IUPAC name is N'-[4,6-bis(3-fluorophenyl)-1,3,5-triazin-2-yl]pentane-1,5-diamine.
| Compound Name | N'-[4,6-bis(3-fluorophenyl)-1,3,5-triazin-2-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 46232292 |
| Molecular Formula | C20H21F2N5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N'-[4,6-bis(3-fluorophenyl)-1,3,5-triazin-2-yl]pentane-1,5-diamine |
| SMILES | NCCCCCNc1nc(-c2cccc(F)c2)nc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C20H21F2N5/c21-16-8-4-6-14(12-16)18-25-19(15-7-5-9-17(22)13-15)27-20(26-18)24-11-3-1-2-10-23/h4-9,12-13H,1-3,10-11,23H2,(H,24,25,26,27) |
| InChIKey | IBUUPMSFQAYNFN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|