C19H23N7O2 — CID 46232472
3-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 46232472) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 46232472 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 3-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc(Nc2nc(N)nc(CN3C(=O)NC4(CCCCC4)C3=O)n2)cc1 |
| InChI | InChI=1S/C19H23N7O2/c1-12-5-7-13(8-6-12)21-17-23-14(22-16(20)24-17)11-26-15(27)19(25-18(26)28)9-3-2-4-10-19/h5-8H,2-4,9-11H2,1H3,(H,25,28)(H3,20,21,22,23,24) |
| InChIKey | LYSQKWDUPSIMCD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|