C20H20N2O6 — CID 46232722
[(3S,3aR,6R,6aR)-6-(phenylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] N-phenylcarbamate (PubChem CID 46232722) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-6-(phenylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] N-phenylcarbamate.
| Compound Name | [(3S,3aR,6R,6aR)-6-(phenylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 46232722 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [(3S,3aR,6R,6aR)-6-(phenylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H20N2O6/c23-19(21-13-7-3-1-4-8-13)27-15-11-25-18-16(12-26-17(15)18)28-20(24)22-14-9-5-2-6-10-14/h1-10,15-18H,11-12H2,(H,21,23)(H,22,24)/t15-,16+,17-,18-/m1/s1 |
| InChIKey | KDDHNJSIHIMRGH-XMTFNYHQSA-N |
| XLogP | 3.02 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |