C21H20N2O6 — CID 46232765
[(E)-[(3S,3aS,6aR)-3-(benzylcarbamoyloxy)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-ylidene]amino] benzoate (PubChem CID 46232765) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is [(E)-[(3S,3aS,6aR)-3-(benzylcarbamoyloxy)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-ylidene]amino] benzoate.
| Compound Name | [(E)-[(3S,3aS,6aR)-3-(benzylcarbamoyloxy)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 46232765 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [(E)-[(3S,3aS,6aR)-3-(benzylcarbamoyloxy)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-ylidene]amino] benzoate |
| SMILES | O=C(NCc1ccccc1)O[C@H]1CO[C@@H]2/C(=N/OC(=O)c3ccccc3)CO[C@H]12 |
| InChI | InChI=1S/C21H20N2O6/c24-20(15-9-5-2-6-10-15)29-23-16-12-26-19-17(13-27-18(16)19)28-21(25)22-11-14-7-3-1-4-8-14/h1-10,17-19H,11-13H2,(H,22,25)/b23-16+/t17-,18+,19+/m0/s1 |
| InChIKey | QSCJIAJBEXCPIT-YBYQCYLXSA-N |
| XLogP | 2.29 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|