C15H18N2O5 — CID 46232767
[(4aS,7S,7aR)-4-methyl-3-oxo-4a,6,7,7a-tetrahydrofuro[3,2-b][1,4]oxazin-7-yl] N-benzylcarbamate (PubChem CID 46232767) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is [(4aS,7S,7aR)-4-methyl-3-oxo-4a,6,7,7a-tetrahydrofuro[3,2-b][1,4]oxazin-7-yl] N-benzylcarbamate.
| Compound Name | [(4aS,7S,7aR)-4-methyl-3-oxo-4a,6,7,7a-tetrahydrofuro[3,2-b][1,4]oxazin-7-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 46232767 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [(4aS,7S,7aR)-4-methyl-3-oxo-4a,6,7,7a-tetrahydrofuro[3,2-b][1,4]oxazin-7-yl] N-benzylcarbamate |
| SMILES | CN1C(=O)CO[C@@H]2[C@@H](OC(=O)NCc3ccccc3)CO[C@@H]21 |
| InChI | InChI=1S/C15H18N2O5/c1-17-12(18)9-20-13-11(8-21-14(13)17)22-15(19)16-7-10-5-3-2-4-6-10/h2-6,11,13-14H,7-9H2,1H3,(H,16,19)/t11-,13+,14-/m0/s1 |
| InChIKey | RHALMFBHSLDXES-YUTCNCBUSA-N |
| XLogP | 0.49 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |