C27H54N2 — CID 46232796
2,2,6,6-tetramethyl-1-[9-(2,2,6,6-tetramethylpiperidin-1-yl)nonyl]piperidine (PubChem CID 46232796) has the molecular formula C27H54N2 and a molecular weight of 406.74 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[9-(2,2,6,6-tetramethylpiperidin-1-yl)nonyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[9-(2,2,6,6-tetramethylpiperidin-1-yl)nonyl]piperidine |
|---|---|
| PubChem CID | 46232796 |
| Molecular Formula | C27H54N2 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.43 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[9-(2,2,6,6-tetramethylpiperidin-1-yl)nonyl]piperidine |
| SMILES | CC1(C)CCCC(C)(C)N1CCCCCCCCCN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C27H54N2/c1-24(2)18-16-19-25(3,4)28(24)22-14-12-10-9-11-13-15-23-29-26(5,6)20-17-21-27(29,7)8/h9-23H2,1-8H3 |
| InChIKey | BABKMDZJEDULJD-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|