C28H56N2 — CID 46232797
2,2,6,6-tetramethyl-1-[10-(2,2,6,6-tetramethylpiperidin-1-yl)decyl]piperidine (PubChem CID 46232797) has the molecular formula C28H56N2 and a molecular weight of 420.77 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[10-(2,2,6,6-tetramethylpiperidin-1-yl)decyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[10-(2,2,6,6-tetramethylpiperidin-1-yl)decyl]piperidine |
|---|---|
| PubChem CID | 46232797 |
| Molecular Formula | C28H56N2 |
| Molecular Weight | 420.77 g/mol |
| Exact Mass | 420.44 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[10-(2,2,6,6-tetramethylpiperidin-1-yl)decyl]piperidine |
| SMILES | CC1(C)CCCC(C)(C)N1CCCCCCCCCCN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C28H56N2/c1-25(2)19-17-20-26(3,4)29(25)23-15-13-11-9-10-12-14-16-24-30-27(5,6)21-18-22-28(30,7)8/h9-24H2,1-8H3 |
| InChIKey | WGSWBLSPUHPABQ-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.77 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|