C21H22N2O5 — CID 46232812
[(3R,3aR,6S,6aS)-3-benzamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate (PubChem CID 46232812) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-3-benzamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate.
| Compound Name | [(3R,3aR,6S,6aS)-3-benzamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 46232812 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [(3R,3aR,6S,6aS)-3-benzamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O5/c24-20(15-9-5-2-6-10-15)23-16-12-26-19-17(13-27-18(16)19)28-21(25)22-11-14-7-3-1-4-8-14/h1-10,16-19H,11-13H2,(H,22,25)(H,23,24)/t16-,17+,18-,19-/m1/s1 |
| InChIKey | UHWPXMYWADFJNZ-FCGDIQPGSA-N |
| XLogP | 1.88 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |