C16H18N4O3 — CID 46232855
1,3,7-trimethyl-8-[(3-methylphenyl)methoxy]purine-2,6-dione (PubChem CID 46232855) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-[(3-methylphenyl)methoxy]purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-[(3-methylphenyl)methoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 46232855 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1,3,7-trimethyl-8-[(3-methylphenyl)methoxy]purine-2,6-dione |
| SMILES | Cc1cccc(COc2nc3c(c(=O)n(C)c(=O)n3C)n2C)c1 |
| InChI | InChI=1S/C16H18N4O3/c1-10-6-5-7-11(8-10)9-23-15-17-13-12(18(15)2)14(21)20(4)16(22)19(13)3/h5-8H,9H2,1-4H3 |
| InChIKey | AFSVTGXZVYXITM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |