C26H28BNO5 — CID 46232961
N-[2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(4-phenylphenoxy)acetamide (PubChem CID 46232961) has the molecular formula C26H28BNO5 and a molecular weight of 445.32 g/mol. Its IUPAC name is N-[2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(4-phenylphenoxy)acetamide.
| Compound Name | N-[2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(4-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 46232961 |
| Molecular Formula | C26H28BNO5 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(4-phenylphenoxy)acetamide |
| SMILES | CC1(C)OB(c2ccc(O)c(NC(=O)COc3ccc(-c4ccccc4)cc3)c2)OC1(C)C |
| InChI | InChI=1S/C26H28BNO5/c1-25(2)26(3,4)33-27(32-25)20-12-15-23(29)22(16-20)28-24(30)17-31-21-13-10-19(11-14-21)18-8-6-5-7-9-18/h5-16,29H,17H2,1-4H3,(H,28,30) |
| InChIKey | RGBWPLFZSXJBAE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|