C32H28N2O3 — CID 46233003
2-[4-[[5-(benzylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 46233003) has the molecular formula C32H28N2O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 2-[4-[[5-(benzylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-(benzylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 46233003 |
| Molecular Formula | C32H28N2O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[4-[[5-(benzylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)NCc3ccccc3)cc12 |
| InChI | InChI=1S/C32H28N2O3/c1-21-22(2)34(20-24-12-14-25(15-13-24)27-10-6-7-11-28(27)32(36)37)30-17-16-26(18-29(21)30)31(35)33-19-23-8-4-3-5-9-23/h3-18H,19-20H2,1-2H3,(H,33,35)(H,36,37) |
| InChIKey | HOWMTYZTQKZIEQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|