About 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine
2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine (PubChem CID 46233383) has the molecular formula C18H23NS
and a molecular weight of 285.46 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine |
| PubChem CID | 46233383 |
| Molecular Formula | C18H23NS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine |
| SMILES | Cc1cccc(C)c1-c1ccccc1SCCN(C)C |
| InChI | InChI=1S/C18H23NS/c1-14-8-7-9-15(2)18(14)16-10-5-6-11-17(16)20-13-12-19(3)4/h5-11H,12-13H2,1-4H3 |
| InChIKey | BMQNAZCGAAXTPA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine?
The IUPAC name of 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine (CID 46233383) is 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine.
What is the SMILES notation for 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine?
The canonical SMILES for 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine is Cc1cccc(C)c1-c1ccccc1SCCN(C)C.
What is the InChIKey of 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine?
The InChIKey is BMQNAZCGAAXTPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NS/c1-14-8-7-9-15(2)18(14)16-10-5-6-11-17(16)20-13-12-19(3)4/h5-11H,12-13H2,1-4H3.
What are the key properties of 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine?
2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine has a molecular weight of 285.46 g/mol, XLogP of 4.62, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,6-dimethylphenyl)phenyl]sulfanyl-N,N-dimethylethanamine is sourced from PubChem (CID 46233383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).