C28H38O3 — CID 46233486
methyl (1R,4S,5R,9S,10S,13R,14S)-5,9-dimethyl-15-oxo-14-(2-phenylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 46233486) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is methyl (1R,4S,5R,9S,10S,13R,14S)-5,9-dimethyl-15-oxo-14-(2-phenylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | methyl (1R,4S,5R,9S,10S,13R,14S)-5,9-dimethyl-15-oxo-14-(2-phenylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 46233486 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | methyl (1R,4S,5R,9S,10S,13R,14S)-5,9-dimethyl-15-oxo-14-(2-phenylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@H]4C[C@@]3(CC[C@@H]21)C(=O)[C@H]4CCc1ccccc1 |
| InChI | InChI=1S/C28H38O3/c1-26-15-7-16-27(2,25(30)31-3)22(26)14-17-28-18-20(11-13-23(26)28)21(24(28)29)12-10-19-8-5-4-6-9-19/h4-6,8-9,20-23H,7,10-18H2,1-3H3/t20-,21+,22+,23+,26-,27-,28-/m1/s1 |
| InChIKey | RZFATQFBCLAZTF-UZVZUNBISA-N |
| XLogP | 6.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |