C18H21NO4S — CID 46233571
(5Z)-5-[[4-(2-cyclohexyloxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 46233571) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is (5Z)-5-[[4-(2-cyclohexyloxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(2-cyclohexyloxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 46233571 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (5Z)-5-[[4-(2-cyclohexyloxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OCCOC3CCCCC3)cc2)S1 |
| InChI | InChI=1S/C18H21NO4S/c20-17-16(24-18(21)19-17)12-13-6-8-15(9-7-13)23-11-10-22-14-4-2-1-3-5-14/h6-9,12,14H,1-5,10-11H2,(H,19,20,21)/b16-12- |
| InChIKey | IEEUGBNDMZQXIA-VBKFSLOCSA-N |
| XLogP | 3.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|