About 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine
3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 46234013) has the molecular formula C23H16N4
and a molecular weight of 348.41 g/mol. Its IUPAC name is 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 46234013 |
| Molecular Formula | C23H16N4 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1cc2cc(-c3cnc4[nH]cc(-c5ccc6[nH]ccc6c5)c4c3)ccc2[nH]1 |
| InChI | InChI=1S/C23H16N4/c1-3-21-16(5-7-24-21)9-14(1)18-11-19-20(13-27-23(19)26-12-18)15-2-4-22-17(10-15)6-8-25-22/h1-13,24-25H,(H,26,27) |
| InChIKey | SQWISTIJOLTLFU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine (CID 46234013) is 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine is c1cc2cc(-c3cnc4[nH]cc(-c5ccc6[nH]ccc6c5)c4c3)ccc2[nH]1.
What is the InChIKey of 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is SQWISTIJOLTLFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4/c1-3-21-16(5-7-24-21)9-14(1)18-11-19-20(13-27-23(19)26-12-18)15-2-4-22-17(10-15)6-8-25-22/h1-13,24-25H,(H,26,27).
What are the key properties of 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine?
3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 348.41 g/mol, XLogP of 5.86, 2 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 46234013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).