C14H18N6O2 — CID 46234405
1-(1-acetylpiperidin-4-yl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea (PubChem CID 46234405) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
|---|---|
| PubChem CID | 46234405 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
| SMILES | CC(=O)N1CCC(NC(=O)Nc2cnc3[nH]ccc3n2)CC1 |
| InChI | InChI=1S/C14H18N6O2/c1-9(21)20-6-3-10(4-7-20)17-14(22)19-12-8-16-13-11(18-12)2-5-15-13/h2,5,8,10H,3-4,6-7H2,1H3,(H,15,16)(H2,17,18,19,22) |
| InChIKey | OENWWNDSTLBVIW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |