C22H16Cl3F3N4O4 — CID 46234697
5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-3-[2,5-dichloro-4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-1,2,4-oxadiazole (PubChem CID 46234697) has the molecular formula C22H16Cl3F3N4O4 and a molecular weight of 563.75 g/mol. Its IUPAC name is 5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-3-[2,5-dichloro-4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-3-[2,5-dichloro-4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46234697 |
| Molecular Formula | C22H16Cl3F3N4O4 |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | 5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-3-[2,5-dichloro-4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-1,2,4-oxadiazole |
| SMILES | CC1(C)OC[C@@H](COc2cc(Cl)c(-c3noc(-c4cn5cc(C(F)(F)F)cc(Cl)c5n4)n3)cc2Cl)O1 |
| InChI | InChI=1S/C22H16Cl3F3N4O4/c1-21(2)34-9-11(35-21)8-33-17-5-13(23)12(4-14(17)24)18-30-20(36-31-18)16-7-32-6-10(22(26,27)28)3-15(25)19(32)29-16/h3-7,11H,8-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | VLSUOEGDQHFYLC-LLVKDONJSA-N |
| XLogP | 6.56 |
| TPSA | 83.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |