C29H44N4O2 — CID 46235006
2-[4-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]-9-(oxan-4-yl)-2,9-diazaspiro[5.5]undecan-1-one (PubChem CID 46235006) has the molecular formula C29H44N4O2 and a molecular weight of 480.70 g/mol. Its IUPAC name is 2-[4-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]-9-(oxan-4-yl)-2,9-diazaspiro[5.5]undecan-1-one.
| Compound Name | 2-[4-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]-9-(oxan-4-yl)-2,9-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 46235006 |
| Molecular Formula | C29H44N4O2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | 2-[4-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]-9-(oxan-4-yl)-2,9-diazaspiro[5.5]undecan-1-one |
| SMILES | C[C@H]1CCCN1[C@H]1CCN(c2ccc(N3CCCC4(CCN(C5CCOCC5)CC4)C3=O)cc2)C1 |
| InChI | InChI=1S/C29H44N4O2/c1-23-4-2-15-32(23)27-9-17-31(22-27)24-5-7-26(8-6-24)33-16-3-12-29(28(33)34)13-18-30(19-14-29)25-10-20-35-21-11-25/h5-8,23,25,27H,2-4,9-22H2,1H3/t23-,27-/m0/s1 |
| InChIKey | ZOYKMWVTQGZHST-HOFKKMOUSA-N |
| XLogP | 4.14 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|