C22H21Cl2FN6 — CID 46235049
N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine (PubChem CID 46235049) has the molecular formula C22H21Cl2FN6 and a molecular weight of 459.36 g/mol. Its IUPAC name is N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine.
| Compound Name | N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine |
|---|---|
| PubChem CID | 46235049 |
| Molecular Formula | C22H21Cl2FN6 |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine |
| SMILES | Fc1ccc(Cl)c(CNn2ccc3ncc(-c4cnn(C5CCNCC5)c4)cc32)c1Cl |
| InChI | InChI=1S/C22H21Cl2FN6/c23-18-1-2-19(25)22(24)17(18)12-29-30-8-5-20-21(30)9-14(10-27-20)15-11-28-31(13-15)16-3-6-26-7-4-16/h1-2,5,8-11,13,16,26,29H,3-4,6-7,12H2 |
| InChIKey | JKZSQDGIBBCJLJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|