C31H39FN4O2 — CID 46235164
8-(4-fluorobenzoyl)-2-[4-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]phenyl]-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 46235164) has the molecular formula C31H39FN4O2 and a molecular weight of 518.68 g/mol. Its IUPAC name is 8-(4-fluorobenzoyl)-2-[4-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]phenyl]-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 8-(4-fluorobenzoyl)-2-[4-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]phenyl]-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 46235164 |
| Molecular Formula | C31H39FN4O2 |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | 8-(4-fluorobenzoyl)-2-[4-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]phenyl]-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | C[C@H]1CCCN1C1CCN(c2ccc(N3CCC4(CCN(C(=O)c5ccc(F)cc5)CC4)C3=O)cc2)CC1 |
| InChI | InChI=1S/C31H39FN4O2/c1-23-3-2-17-35(23)28-12-18-33(19-13-28)26-8-10-27(11-9-26)36-22-16-31(30(36)38)14-20-34(21-15-31)29(37)24-4-6-25(32)7-5-24/h4-11,23,28H,2-3,12-22H2,1H3/t23-/m0/s1 |
| InChIKey | ORMNFPDDUZBUJR-QHCPKHFHSA-N |
| XLogP | 4.94 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|