C33H50O6 — CID 46235501
(7E,16E,19Z)-4,6,10,14-tetrahydroxy-12,21-dimethyl-22-[(1E,3E,5Z)-3-methylnona-1,3,5,8-tetraenyl]-1-oxacyclodocosa-7,16,19-trien-2-one (PubChem CID 46235501) has the molecular formula C33H50O6 and a molecular weight of 542.76 g/mol. Its IUPAC name is (7E,16E,19Z)-4,6,10,14-tetrahydroxy-12,21-dimethyl-22-[(1E,3E,5Z)-3-methylnona-1,3,5,8-tetraenyl]-1-oxacyclodocosa-7,16,19-trien-2-one.
| Compound Name | (7E,16E,19Z)-4,6,10,14-tetrahydroxy-12,21-dimethyl-22-[(1E,3E,5Z)-3-methylnona-1,3,5,8-tetraenyl]-1-oxacyclodocosa-7,16,19-trien-2-one |
|---|---|
| PubChem CID | 46235501 |
| Molecular Formula | C33H50O6 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | (7E,16E,19Z)-4,6,10,14-tetrahydroxy-12,21-dimethyl-22-[(1E,3E,5Z)-3-methylnona-1,3,5,8-tetraenyl]-1-oxacyclodocosa-7,16,19-trien-2-one |
| SMILES | C=CC/C=C\C=C(C)\C=C\C1OC(=O)CC(O)CC(O)/C=C/CC(O)CC(C)CC(O)C/C=C/C/C=C\C1C |
| InChI | InChI=1S/C33H50O6/c1-5-6-7-10-14-25(2)19-20-32-27(4)15-11-8-9-12-16-28(34)21-26(3)22-29(35)17-13-18-30(36)23-31(37)24-33(38)39-32/h5,7,9-15,18-20,26-32,34-37H,1,6,8,16-17,21-24H2,2-4H3/b10-7-,12-9+,15-11-,18-13+,20-19+,25-14+ |
| InChIKey | UAMWSMPMWGFABN-KQJPUOQGSA-N |
| XLogP | 5.66 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|