C24H27FN4O4S — CID 46235706
2-deuterio-1-[(2S,5R)-5-(2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethylamino)oxan-2-yl]-2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethanol (PubChem CID 46235706) has the molecular formula C24H27FN4O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is 2-deuterio-1-[(2S,5R)-5-(2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethylamino)oxan-2-yl]-2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethanol.
| Compound Name | 2-deuterio-1-[(2S,5R)-5-(2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethylamino)oxan-2-yl]-2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethanol |
|---|---|
| PubChem CID | 46235706 |
| Molecular Formula | C24H27FN4O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-deuterio-1-[(2S,5R)-5-(2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethylamino)oxan-2-yl]-2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethanol |
| SMILES | [2H]C(c1c(F)cnc2ccc(OC)nc12)C(O)[C@@H]1CC[C@@H](NCc2cc3c(cn2)OCCS3)CO1 |
| InChI | InChI=1S/C24H27FN4O4S/c1-31-23-5-3-18-24(29-23)16(17(25)11-28-18)9-19(30)20-4-2-14(13-33-20)26-10-15-8-22-21(12-27-15)32-6-7-34-22/h3,5,8,11-12,14,19-20,26,30H,2,4,6-7,9-10,13H2,1H3/t14-,19?,20+/m1/s1/i9D/t9?,14-,19?,20+ |
| InChIKey | KPBDAHXJWWWRCG-YQMQLQRJSA-N |
| XLogP | 2.90 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |