C23H24ClF2N5O — CID 46236147
8-chloro-5-(2-fluoroethyl)-1-[4-[(5-fluoro-2-pyridinyl)oxy]cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 46236147) has the molecular formula C23H24ClF2N5O and a molecular weight of 459.93 g/mol. Its IUPAC name is 8-chloro-5-(2-fluoroethyl)-1-[4-[(5-fluoro-2-pyridinyl)oxy]cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-5-(2-fluoroethyl)-1-[4-[(5-fluoro-2-pyridinyl)oxy]cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 46236147 |
| Molecular Formula | C23H24ClF2N5O |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 8-chloro-5-(2-fluoroethyl)-1-[4-[(5-fluoro-2-pyridinyl)oxy]cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | FCCN1Cc2cc(Cl)ccc2-n2c(nnc2C2CCC(Oc3ccc(F)cn3)CC2)C1 |
| InChI | InChI=1S/C23H24ClF2N5O/c24-17-3-7-20-16(11-17)13-30(10-9-25)14-21-28-29-23(31(20)21)15-1-5-19(6-2-15)32-22-8-4-18(26)12-27-22/h3-4,7-8,11-12,15,19H,1-2,5-6,9-10,13-14H2 |
| InChIKey | BAFAWQAUAHNVCR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |