About 11-aminododecan-1-ol
11-aminododecan-1-ol (PubChem CID 46236338) has the molecular formula C12H27NO
and a molecular weight of 201.35 g/mol. Its IUPAC name is 11-aminododecan-1-ol.
Molecular Properties
| Compound Name | 11-aminododecan-1-ol |
| PubChem CID | 46236338 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | 11-aminododecan-1-ol |
| SMILES | CC(N)CCCCCCCCCCO |
| InChI | InChI=1S/C12H27NO/c1-12(13)10-8-6-4-2-3-5-7-9-11-14/h12,14H,2-11,13H2,1H3 |
| InChIKey | BCKREPAWHWJHRF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11-aminododecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-aminododecan-1-ol?
The IUPAC name of 11-aminododecan-1-ol (CID 46236338) is 11-aminododecan-1-ol.
What is the SMILES notation for 11-aminododecan-1-ol?
The canonical SMILES for 11-aminododecan-1-ol is CC(N)CCCCCCCCCCO.
What is the InChIKey of 11-aminododecan-1-ol?
The InChIKey is BCKREPAWHWJHRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO/c1-12(13)10-8-6-4-2-3-5-7-9-11-14/h12,14H,2-11,13H2,1H3.
What are the key properties of 11-aminododecan-1-ol?
11-aminododecan-1-ol has a molecular weight of 201.35 g/mol, XLogP of 2.84, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-aminododecan-1-ol is sourced from PubChem (CID 46236338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).