About 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide
3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide (PubChem CID 46236611) has the molecular formula C15H11F2N3O2S
and a molecular weight of 335.34 g/mol. Its IUPAC name is 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide |
| PubChem CID | 46236611 |
| Molecular Formula | C15H11F2N3O2S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide |
| SMILES | NC(=O)c1c(F)ccc(OCc2nc3cc(N)ccc3s2)c1F |
| InChI | InChI=1S/C15H11F2N3O2S/c16-8-2-3-10(14(17)13(8)15(19)21)22-6-12-20-9-5-7(18)1-4-11(9)23-12/h1-5H,6,18H2,(H2,19,21) |
| InChIKey | DMMJZTANRQZYGQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide?
The IUPAC name of 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide (CID 46236611) is 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide.
What is the SMILES notation for 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide?
The canonical SMILES for 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide is NC(=O)c1c(F)ccc(OCc2nc3cc(N)ccc3s2)c1F.
What is the InChIKey of 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide?
The InChIKey is DMMJZTANRQZYGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2N3O2S/c16-8-2-3-10(14(17)13(8)15(19)21)22-6-12-20-9-5-7(18)1-4-11(9)23-12/h1-5H,6,18H2,(H2,19,21).
What are the key properties of 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide?
3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide has a molecular weight of 335.34 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-amino-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide is sourced from PubChem (CID 46236611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).