About 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide
3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide (PubChem CID 46236895) has the molecular formula C14H8F2N2O2S
and a molecular weight of 306.29 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide |
| PubChem CID | 46236895 |
| Molecular Formula | C14H8F2N2O2S |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide |
| SMILES | NC(=O)c1c(F)ccc(Oc2nc3ccccc3s2)c1F |
| InChI | InChI=1S/C14H8F2N2O2S/c15-7-5-6-9(12(16)11(7)13(17)19)20-14-18-8-3-1-2-4-10(8)21-14/h1-6H,(H2,17,19) |
| InChIKey | VKLBVECMRUTRNV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide?
The IUPAC name of 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide (CID 46236895) is 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide.
What is the SMILES notation for 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide?
The canonical SMILES for 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide is NC(=O)c1c(F)ccc(Oc2nc3ccccc3s2)c1F.
What is the InChIKey of 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide?
The InChIKey is VKLBVECMRUTRNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F2N2O2S/c15-7-5-6-9(12(16)11(7)13(17)19)20-14-18-8-3-1-2-4-10(8)21-14/h1-6H,(H2,17,19).
What are the key properties of 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide?
3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide has a molecular weight of 306.29 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-2-yloxy)-2,6-difluorobenzamide is sourced from PubChem (CID 46236895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).