C18H19N3O4 — CID 46237053
1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole (PubChem CID 46237053) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole.
| Compound Name | 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 46237053 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole |
| SMILES | COc1ccc(-n2ncnc2-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H19N3O4/c1-22-14-7-5-13(6-8-14)21-18(19-11-20-21)12-9-15(23-2)17(25-4)16(10-12)24-3/h5-11H,1-4H3 |
| InChIKey | OAJOQIBDSPEKAQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |