About 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide
3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide (PubChem CID 46237134) has the molecular formula C17H15F2N3O2S
and a molecular weight of 363.39 g/mol. Its IUPAC name is 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide |
| PubChem CID | 46237134 |
| Molecular Formula | C17H15F2N3O2S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide |
| SMILES | CN(C)c1ccc2sc(COc3ccc(F)c(C(N)=O)c3F)nc2c1 |
| InChI | InChI=1S/C17H15F2N3O2S/c1-22(2)9-3-6-13-11(7-9)21-14(25-13)8-24-12-5-4-10(18)15(16(12)19)17(20)23/h3-7H,8H2,1-2H3,(H2,20,23) |
| InChIKey | JJTXMWLXISGCOX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide?
The IUPAC name of 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide (CID 46237134) is 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide.
What is the SMILES notation for 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide?
The canonical SMILES for 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide is CN(C)c1ccc2sc(COc3ccc(F)c(C(N)=O)c3F)nc2c1.
What is the InChIKey of 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide?
The InChIKey is JJTXMWLXISGCOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N3O2S/c1-22(2)9-3-6-13-11(7-9)21-14(25-13)8-24-12-5-4-10(18)15(16(12)19)17(20)23/h3-7H,8H2,1-2H3,(H2,20,23).
What are the key properties of 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide?
3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide has a molecular weight of 363.39 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(dimethylamino)-1,3-benzothiazol-2-yl]methoxy]-2,6-difluorobenzamide is sourced from PubChem (CID 46237134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).