C28H29N7O2 — CID 46237140
1-[4-[1-ethyl-4-[2-[(2-hydroxyethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea (PubChem CID 46237140) has the molecular formula C28H29N7O2 and a molecular weight of 495.59 g/mol. Its IUPAC name is 1-[4-[1-ethyl-4-[2-[(2-hydroxyethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[1-ethyl-4-[2-[(2-hydroxyethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 46237140 |
| Molecular Formula | C28H29N7O2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 1-[4-[1-ethyl-4-[2-[(2-hydroxyethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea |
| SMILES | CCn1cc(-c2ccnc3[nH]c(CNCCO)cc23)c(-c2ccc(NC(=O)Nc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C28H29N7O2/c1-2-35-18-25(23-12-13-30-27-24(23)16-22(31-27)17-29-14-15-36)26(34-35)19-8-10-21(11-9-19)33-28(37)32-20-6-4-3-5-7-20/h3-13,16,18,29,36H,2,14-15,17H2,1H3,(H,30,31)(H2,32,33,37) |
| InChIKey | SKNITDPTVHFEGL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|