C29H31N7O3S — CID 46237142
1-[4-[1-ethyl-4-[2-[(2-methylsulfonylethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea (PubChem CID 46237142) has the molecular formula C29H31N7O3S and a molecular weight of 557.68 g/mol. Its IUPAC name is 1-[4-[1-ethyl-4-[2-[(2-methylsulfonylethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[1-ethyl-4-[2-[(2-methylsulfonylethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 46237142 |
| Molecular Formula | C29H31N7O3S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 1-[4-[1-ethyl-4-[2-[(2-methylsulfonylethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea |
| SMILES | CCn1cc(-c2ccnc3[nH]c(CNCCS(C)(=O)=O)cc23)c(-c2ccc(NC(=O)Nc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C29H31N7O3S/c1-3-36-19-26(24-13-14-31-28-25(24)17-23(32-28)18-30-15-16-40(2,38)39)27(35-36)20-9-11-22(12-10-20)34-29(37)33-21-7-5-4-6-8-21/h4-14,17,19,30H,3,15-16,18H2,1-2H3,(H,31,32)(H2,33,34,37) |
| InChIKey | KEZAFIAURWAGLZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|