C32H36N8O2 — CID 46237143
1-[4-[1-ethyl-4-[2-[(2-morpholin-4-ylethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea (PubChem CID 46237143) has the molecular formula C32H36N8O2 and a molecular weight of 564.69 g/mol. Its IUPAC name is 1-[4-[1-ethyl-4-[2-[(2-morpholin-4-ylethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[1-ethyl-4-[2-[(2-morpholin-4-ylethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 46237143 |
| Molecular Formula | C32H36N8O2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 1-[4-[1-ethyl-4-[2-[(2-morpholin-4-ylethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-3-phenylurea |
| SMILES | CCn1cc(-c2ccnc3[nH]c(CNCCN4CCOCC4)cc23)c(-c2ccc(NC(=O)Nc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C32H36N8O2/c1-2-40-22-29(30(38-40)23-8-10-25(11-9-23)37-32(41)36-24-6-4-3-5-7-24)27-12-13-34-31-28(27)20-26(35-31)21-33-14-15-39-16-18-42-19-17-39/h3-13,20,22,33H,2,14-19,21H2,1H3,(H,34,35)(H2,36,37,41) |
| InChIKey | JPQQLLUZYXRSBP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|