About 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide
3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide (PubChem CID 46237273) has the molecular formula C15H9ClF2N2O2S
and a molecular weight of 354.77 g/mol. Its IUPAC name is 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide |
| PubChem CID | 46237273 |
| Molecular Formula | C15H9ClF2N2O2S |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide |
| SMILES | NC(=O)c1c(F)ccc(OCc2nc3cccc(Cl)c3s2)c1F |
| InChI | InChI=1S/C15H9ClF2N2O2S/c16-7-2-1-3-9-14(7)23-11(20-9)6-22-10-5-4-8(17)12(13(10)18)15(19)21/h1-5H,6H2,(H2,19,21) |
| InChIKey | LGOSANGMAUVFOY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide?
The IUPAC name of 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide (CID 46237273) is 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide.
What is the SMILES notation for 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide?
The canonical SMILES for 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide is NC(=O)c1c(F)ccc(OCc2nc3cccc(Cl)c3s2)c1F.
What is the InChIKey of 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide?
The InChIKey is LGOSANGMAUVFOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClF2N2O2S/c16-7-2-1-3-9-14(7)23-11(20-9)6-22-10-5-4-8(17)12(13(10)18)15(19)21/h1-5H,6H2,(H2,19,21).
What are the key properties of 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide?
3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide has a molecular weight of 354.77 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorobenzamide is sourced from PubChem (CID 46237273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).