C19H20ClN3O4 — CID 46237319
5-(3-chloro-4-ethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)-1,2,4-triazole (PubChem CID 46237319) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is 5-(3-chloro-4-ethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)-1,2,4-triazole.
| Compound Name | 5-(3-chloro-4-ethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 46237319 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 5-(3-chloro-4-ethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)-1,2,4-triazole |
| SMILES | CCOc1ccc(-c2ncnn2-c2cc(OC)c(OC)c(OC)c2)cc1Cl |
| InChI | InChI=1S/C19H20ClN3O4/c1-5-27-15-7-6-12(8-14(15)20)19-21-11-22-23(19)13-9-16(24-2)18(26-4)17(10-13)25-3/h6-11H,5H2,1-4H3 |
| InChIKey | KCDYBDAYAYTMDF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |