C19H21NO4S — CID 46237632
ethyl (2R,3R)-1-(4-methylphenyl)sulfonyl-3-phenylazetidine-2-carboxylate (PubChem CID 46237632) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is ethyl (2R,3R)-1-(4-methylphenyl)sulfonyl-3-phenylazetidine-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1-(4-methylphenyl)sulfonyl-3-phenylazetidine-2-carboxylate |
|---|---|
| PubChem CID | 46237632 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | ethyl (2R,3R)-1-(4-methylphenyl)sulfonyl-3-phenylazetidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](c2ccccc2)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-3-24-19(21)18-17(15-7-5-4-6-8-15)13-20(18)25(22,23)16-11-9-14(2)10-12-16/h4-12,17-18H,3,13H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | XRNCDTWTKODVEW-ZWKOTPCHSA-N |
| XLogP | 2.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |