C15H24O5 — CID 46237778
(1R,6R,9Z,12S)-2-hydroxy-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadec-9-en-4-one (PubChem CID 46237778) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1R,6R,9Z,12S)-2-hydroxy-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadec-9-en-4-one.
| Compound Name | (1R,6R,9Z,12S)-2-hydroxy-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadec-9-en-4-one |
|---|---|
| PubChem CID | 46237778 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1R,6R,9Z,12S)-2-hydroxy-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadec-9-en-4-one |
| SMILES | C[C@@H]1CC/C=C\C[C@@H]2OC(C)(C)O[C@@H]2C(O)CC(=O)O1 |
| InChI | InChI=1S/C15H24O5/c1-10-7-5-4-6-8-12-14(20-15(2,3)19-12)11(16)9-13(17)18-10/h4,6,10-12,14,16H,5,7-9H2,1-3H3/b6-4-/t10-,11?,12+,14-/m1/s1 |
| InChIKey | VFDLXYUDGDTNNL-ILDSLNBHSA-N |
| XLogP | 1.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|