C32H38O5 — CID 46237838
ethyl 2-acetyl-5-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1,3-dihydroindene-2-carboxylate (PubChem CID 46237838) has the molecular formula C32H38O5 and a molecular weight of 502.65 g/mol. Its IUPAC name is ethyl 2-acetyl-5-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethyl 2-acetyl-5-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 46237838 |
| Molecular Formula | C32H38O5 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | ethyl 2-acetyl-5-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1,3-dihydroindene-2-carboxylate |
| SMILES | CCOC(=O)C1(C(C)=O)Cc2ccc([C@]3(O)CC[C@H]4[C@@H]5CCc6cc(O)ccc6[C@H]5CC[C@@]43C)cc2C1 |
| InChI | InChI=1S/C32H38O5/c1-4-37-29(35)31(19(2)33)17-21-5-7-23(15-22(21)18-31)32(36)14-12-28-27-9-6-20-16-24(34)8-10-25(20)26(27)11-13-30(28,32)3/h5,7-8,10,15-16,26-28,34,36H,4,6,9,11-14,17-18H2,1-3H3/t26-,27-,28+,30+,31?,32-/m1/s1 |
| InChIKey | MHEQZALMUWNYOD-RECUOTGHSA-N |
| XLogP | 5.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|