C15H11N5O2S — CID 46237860
3-[(E)-(4-nitrophenyl)methylideneamino]-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 46237860) has the molecular formula C15H11N5O2S and a molecular weight of 325.35 g/mol. Its IUPAC name is 3-[(E)-(4-nitrophenyl)methylideneamino]-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(E)-(4-nitrophenyl)methylideneamino]-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 46237860 |
| Molecular Formula | C15H11N5O2S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-[(E)-(4-nitrophenyl)methylideneamino]-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1ccc(/C=N/c2n[nH]c(=S)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H11N5O2S/c21-20(22)13-8-6-11(7-9-13)10-16-14-17-18-15(23)19(14)12-4-2-1-3-5-12/h1-10H,(H,18,23)/b16-10+ |
| InChIKey | SIFCNKGNLCZODI-MHWRWJLKSA-N |
| XLogP | 3.59 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|